C27H38O6 — CID 20820796
1-O-(2-methyl-2-adamantyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-ethyl-4-methylpentanedioate (PubChem CID 20820796) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is 1-O-(2-methyl-2-adamantyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-ethyl-4-methylpentanedioate.
| Compound Name | 1-O-(2-methyl-2-adamantyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-ethyl-4-methylpentanedioate |
|---|---|
| PubChem CID | 20820796 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 1-O-(2-methyl-2-adamantyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-ethyl-4-methylpentanedioate |
| SMILES | CCC(CC(C)C(=O)OC1C2CC3C(=O)OC1C3C2)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C27H38O6/c1-4-16(25(29)33-27(3)18-7-14-6-15(9-18)10-19(27)8-14)5-13(2)24(28)31-22-17-11-20-21(12-17)26(30)32-23(20)22/h13-23H,4-12H2,1-3H3 |
| InChIKey | ZQTJWHMWGGUTEQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|