C26H34O6 — CID 159781749
(2-ethyl-2-adamantyl) prop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) prop-2-enoate (PubChem CID 159781749) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is (2-ethyl-2-adamantyl) prop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) prop-2-enoate.
| Compound Name | (2-ethyl-2-adamantyl) prop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 159781749 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (2-ethyl-2-adamantyl) prop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(CC)C2CC3CC(C2)CC1C3.C=CC(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C15H22O2.C11H12O4/c1-3-14(16)17-15(4-2)12-6-10-5-11(8-12)9-13(15)7-10;1-2-8(12)14-9-5-3-6-7(4-5)11(13)15-10(6)9/h3,10-13H,1,4-9H2,2H3;2,5-7,9-10H,1,3-4H2 |
| InChIKey | NHLGTTGOWMDWPK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|