C27H34O7 — CID 160553132
(2-methyl-6-oxo-2-adamantyl) 2-methylprop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate (PubChem CID 160553132) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is (2-methyl-6-oxo-2-adamantyl) 2-methylprop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (2-methyl-6-oxo-2-adamantyl) 2-methylprop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160553132 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (2-methyl-6-oxo-2-adamantyl) 2-methylprop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C)C2CC3CC1CC(C2)C3=O.C=C(C)C(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C15H20O3.C12H14O4/c1-8(2)14(17)18-15(3)11-4-9-5-12(15)7-10(6-11)13(9)16;1-5(2)11(13)15-9-6-3-7-8(4-6)12(14)16-10(7)9/h9-12H,1,4-7H2,2-3H3;6-10H,1,3-4H2,2H3 |
| InChIKey | QYIIZXWHDIDBGJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|