C21H26O7 — CID 159173687
(5-methylidene-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-methylprop-2-enoate (PubChem CID 159173687) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is (5-methylidene-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-methylprop-2-enoate.
| Compound Name | (5-methylidene-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159173687 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (5-methylidene-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C2CC3C(=C)OC1C3C2.C=C(C)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C13H16O3.C8H10O4/c1-6(2)13(14)16-11-8-4-9-7(3)15-12(11)10(9)5-8;1-5(2)7(9)12-6-3-4-11-8(6)10/h8-12H,1,3-5H2,2H3;6H,1,3-4H2,2H3 |
| InChIKey | KLZWLAHAXZLMAJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|