C28H32F2O12 — CID 159269686
(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-fluoroprop-2-enoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-fluoroprop-2-enoate (PubChem CID 159269686) has the molecular formula C28H32F2O12 and a molecular weight of 598.55 g/mol. Its IUPAC name is (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-fluoroprop-2-enoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-fluoroprop-2-enoate.
| Compound Name | (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-fluoroprop-2-enoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 159269686 |
| Molecular Formula | C28H32F2O12 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-fluoroprop-2-enoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-fluoroprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C(=O)OC2CCCC21.C=C(F)C(=O)OC1C(=O)OC2CCCC21.C=C(F)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C11H14O4.C10H11FO4.C7H7FO4/c1-6(2)10(12)15-9-7-4-3-5-8(7)14-11(9)13;1-5(11)9(12)15-8-6-3-2-4-7(6)14-10(8)13;1-4(8)6(9)12-5-2-3-11-7(5)10/h7-9H,1,3-5H2,2H3;6-8H,1-4H2;5H,1-3H2 |
| InChIKey | KXNVMVBMAKLEMD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|