C20H24O8 — CID 159949419
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-methylprop-2-enoate (PubChem CID 159949419) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-methylprop-2-enoate.
| Compound Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159949419 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) 2-methylprop-2-enoate;(2-oxooxolan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C(=O)O1)C2C3.C=C(C)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C12H14O4.C8H10O4/c1-6(2)10(13)15-12-5-7-3-8(9(12)4-7)11(14)16-12;1-5(2)7(9)12-6-3-4-11-8(6)10/h7-9H,1,3-5H2,2H3;6H,1,3-4H2,2H3 |
| InChIKey | OBXJQXIVVVYURB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|