C10H16O4 — CID 143365262
ethane;(2-oxooxolan-3-yl) 2-methylprop-2-enoate (PubChem CID 143365262) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is ethane;(2-oxooxolan-3-yl) 2-methylprop-2-enoate.
| Compound Name | ethane;(2-oxooxolan-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143365262 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | ethane;(2-oxooxolan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCOC1=O.CC |
| InChI | InChI=1S/C8H10O4.C2H6/c1-5(2)7(9)12-6-3-4-11-8(6)10;1-2/h6H,1,3-4H2,2H3;1-2H3 |
| InChIKey | RKYQSMARAZRGDB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|