C14H20N2O7 — CID 20643781
2-[[3-oxo-3-(2-oxooxolan-3-yl)oxypropyl]carbamoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 20643781) has the molecular formula C14H20N2O7 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-[[3-oxo-3-(2-oxooxolan-3-yl)oxypropyl]carbamoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[3-oxo-3-(2-oxooxolan-3-yl)oxypropyl]carbamoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20643781 |
| Molecular Formula | C14H20N2O7 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[[3-oxo-3-(2-oxooxolan-3-yl)oxypropyl]carbamoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)NCCC(=O)OC1CCOC1=O |
| InChI | InChI=1S/C14H20N2O7/c1-9(2)12(18)22-8-6-16-14(20)15-5-3-11(17)23-10-4-7-21-13(10)19/h10H,1,3-8H2,2H3,(H2,15,16,20) |
| InChIKey | LERDBOXXIJCDMU-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|