C16H24O8 — CID 20776580
1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(2-oxooxolan-3-yl) butanedioate (PubChem CID 20776580) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(2-oxooxolan-3-yl) butanedioate.
| Compound Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(2-oxooxolan-3-yl) butanedioate |
|---|---|
| PubChem CID | 20776580 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(2-oxooxolan-3-yl) butanedioate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)CCC(=O)OC1CCOC1=O |
| InChI | InChI=1S/C16H24O8/c1-4-16(2,3)15(20)23-10-9-21-12(17)5-6-13(18)24-11-7-8-22-14(11)19/h11H,4-10H2,1-3H3 |
| InChIKey | GJZYSMAEXDGZRI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|