About (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate
(2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate (PubChem CID 134267853) has the molecular formula C13H23NO4
and a molecular weight of 257.33 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate.
Analyze (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate?
The IUPAC name of (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate (CID 134267853) is (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate.
What is the SMILES notation for (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate?
The canonical SMILES for (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate is CC(C)(C)CC(C)(CN)C(=O)OC1CCOC1=O.
What is the InChIKey of (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate?
The InChIKey is AMCBPRGRFHKUPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO4/c1-12(2,3)7-13(4,8-14)11(16)18-9-5-6-17-10(9)15/h9H,5-8,14H2,1-4H3.
What are the key properties of (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate?
(2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate has a molecular weight of 257.33 g/mol, XLogP of 1.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxolan-3-yl) 2-(aminomethyl)-2,4,4-trimethylpentanoate is sourced from PubChem (CID 134267853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).