C23H38O8 — CID 59893054
2-ethyl-2,4,6,6-tetramethyl-7-oxo-4-(2-oxooxolan-3-yl)oxycarbonyl-7-pentoxyheptanoic acid (PubChem CID 59893054) has the molecular formula C23H38O8 and a molecular weight of 442.55 g/mol. Its IUPAC name is 2-ethyl-2,4,6,6-tetramethyl-7-oxo-4-(2-oxooxolan-3-yl)oxycarbonyl-7-pentoxyheptanoic acid.
| Compound Name | 2-ethyl-2,4,6,6-tetramethyl-7-oxo-4-(2-oxooxolan-3-yl)oxycarbonyl-7-pentoxyheptanoic acid |
|---|---|
| PubChem CID | 59893054 |
| Molecular Formula | C23H38O8 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-ethyl-2,4,6,6-tetramethyl-7-oxo-4-(2-oxooxolan-3-yl)oxycarbonyl-7-pentoxyheptanoic acid |
| SMILES | CCCCCOC(=O)C(C)(C)CC(C)(CC(C)(CC)C(=O)O)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C23H38O8/c1-7-9-10-12-30-19(27)21(3,4)14-23(6,15-22(5,8-2)18(25)26)20(28)31-16-11-13-29-17(16)24/h16H,7-15H2,1-6H3,(H,25,26) |
| InChIKey | LQLGWXFWDWBLEU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|