C16H30O4 — CID 157284410
1-O-butyl 5-O-ethyl 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 157284410) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 1-O-butyl 5-O-ethyl 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-butyl 5-O-ethyl 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 157284410 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 1-O-butyl 5-O-ethyl 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCCCOC(=O)C(C)(C)CC(C)(CC)C(=O)OCC |
| InChI | InChI=1S/C16H30O4/c1-7-10-11-20-13(17)15(4,5)12-16(6,8-2)14(18)19-9-3/h7-12H2,1-6H3 |
| InChIKey | FAEZHGMUIXKWKD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|