C18H32O4 — CID 58612876
ethyl 4-acetyl-2-ethyl-2,4,6,6-tetramethyl-7-oxooctanoate (PubChem CID 58612876) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is ethyl 4-acetyl-2-ethyl-2,4,6,6-tetramethyl-7-oxooctanoate.
| Compound Name | ethyl 4-acetyl-2-ethyl-2,4,6,6-tetramethyl-7-oxooctanoate |
|---|---|
| PubChem CID | 58612876 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | ethyl 4-acetyl-2-ethyl-2,4,6,6-tetramethyl-7-oxooctanoate |
| SMILES | CCOC(=O)C(C)(CC)CC(C)(CC(C)(C)C(C)=O)C(C)=O |
| InChI | InChI=1S/C18H32O4/c1-9-17(7,15(21)22-10-2)12-18(8,14(4)20)11-16(5,6)13(3)19/h9-12H2,1-8H3 |
| InChIKey | LDXADULVAVSNLF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |