C20H34O8 — CID 118602079
7-(2-acetyloxyethoxy)-4-ethoxycarbonyl-2-ethyl-2,4,6,6-tetramethyl-7-oxoheptanoic acid (PubChem CID 118602079) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is 7-(2-acetyloxyethoxy)-4-ethoxycarbonyl-2-ethyl-2,4,6,6-tetramethyl-7-oxoheptanoic acid.
| Compound Name | 7-(2-acetyloxyethoxy)-4-ethoxycarbonyl-2-ethyl-2,4,6,6-tetramethyl-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 118602079 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 7-(2-acetyloxyethoxy)-4-ethoxycarbonyl-2-ethyl-2,4,6,6-tetramethyl-7-oxoheptanoic acid |
| SMILES | CCOC(=O)C(C)(CC(C)(C)C(=O)OCCOC(C)=O)CC(C)(CC)C(=O)O |
| InChI | InChI=1S/C20H34O8/c1-8-19(6,15(22)23)13-20(7,17(25)26-9-2)12-18(4,5)16(24)28-11-10-27-14(3)21/h8-13H2,1-7H3,(H,22,23) |
| InChIKey | YGBOPGDRUWBEBJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|