C23H46O7Si2 — CID 22982942
7-ethoxy-2-ethyl-4-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]methoxycarbonyl]-2,4,6,6-tetramethyl-7-oxoheptanoic acid (PubChem CID 22982942) has the molecular formula C23H46O7Si2 and a molecular weight of 490.79 g/mol. Its IUPAC name is 7-ethoxy-2-ethyl-4-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]methoxycarbonyl]-2,4,6,6-tetramethyl-7-oxoheptanoic acid.
| Compound Name | 7-ethoxy-2-ethyl-4-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]methoxycarbonyl]-2,4,6,6-tetramethyl-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 22982942 |
| Molecular Formula | C23H46O7Si2 |
| Molecular Weight | 490.79 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 7-ethoxy-2-ethyl-4-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]methoxycarbonyl]-2,4,6,6-tetramethyl-7-oxoheptanoic acid |
| SMILES | CCOC(=O)C(C)(C)CC(C)(CC(C)(CC)C(=O)O)C(=O)OC[Si](C)(C)O[Si](C)(C)CC |
| InChI | InChI=1S/C23H46O7Si2/c1-12-22(6,18(24)25)16-23(7,15-21(4,5)19(26)28-13-2)20(27)29-17-32(10,11)30-31(8,9)14-3/h12-17H2,1-11H3,(H,24,25) |
| InChIKey | SYGCBHDEXZYYKY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.79 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|