About 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate
1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 20643559) has the molecular formula C15H30O7Si
and a molecular weight of 350.48 g/mol. Its IUPAC name is 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate |
| PubChem CID | 20643559 |
| Molecular Formula | C15H30O7Si |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OC[Si](OC)(OC)OC)C(=O)OC |
| InChI | InChI=1S/C15H30O7Si/c1-9-15(4,13(17)18-5)10-14(2,3)12(16)22-11-23(19-6,20-7)21-8/h9-11H2,1-8H3 |
| InChIKey | LROLJILRDMJZQN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate?
The IUPAC name of 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate (CID 20643559) is 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate.
What is the SMILES notation for 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate?
The canonical SMILES for 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate is CCC(C)(CC(C)(C)C(=O)OC[Si](OC)(OC)OC)C(=O)OC.
What is the InChIKey of 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate?
The InChIKey is LROLJILRDMJZQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O7Si/c1-9-15(4,13(17)18-5)10-14(2,3)12(16)22-11-23(19-6,20-7)21-8/h9-11H2,1-8H3.
What are the key properties of 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate?
1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate has a molecular weight of 350.48 g/mol, XLogP of 1.95, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 5-O-(trimethoxysilylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate is sourced from PubChem (CID 20643559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).