C22H36O6 — CID 59881137
5-O-but-2-enyl 3-O-methyl 1-O-prop-2-enyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 59881137) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is 5-O-but-2-enyl 3-O-methyl 1-O-prop-2-enyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-but-2-enyl 3-O-methyl 1-O-prop-2-enyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59881137 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 5-O-but-2-enyl 3-O-methyl 1-O-prop-2-enyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | C=CCOC(=O)C(C)(C)CC(C)(CC(C)(CC)C(=O)OCC=CC)C(=O)OC |
| InChI | InChI=1S/C22H36O6/c1-9-12-14-28-19(25)21(6,11-3)16-22(7,18(24)26-8)15-20(4,5)17(23)27-13-10-2/h9-10,12H,2,11,13-16H2,1,3-8H3 |
| InChIKey | RZBQRFCBKGPBBZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|