C15H23Br3O6 — CID 20741150
1-O-methyl 5-O-[2-(2,2,2-tribromoacetyl)oxyethyl] 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 20741150) has the molecular formula C15H23Br3O6 and a molecular weight of 539.06 g/mol. Its IUPAC name is 1-O-methyl 5-O-[2-(2,2,2-tribromoacetyl)oxyethyl] 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-methyl 5-O-[2-(2,2,2-tribromoacetyl)oxyethyl] 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 20741150 |
| Molecular Formula | C15H23Br3O6 |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 535.90 |
| IUPAC Name | 1-O-methyl 5-O-[2-(2,2,2-tribromoacetyl)oxyethyl] 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCOC(=O)C(Br)(Br)Br)C(=O)OC |
| InChI | InChI=1S/C15H23Br3O6/c1-6-14(4,11(20)22-5)9-13(2,3)10(19)23-7-8-24-12(21)15(16,17)18/h6-9H2,1-5H3 |
| InChIKey | MRNXZGGPPGEQAQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|