C14H23Br3O5 — CID 59343000
1-O-(2-hydroxyethyl) 5-O-(2,2,2-tribromoethyl) 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 59343000) has the molecular formula C14H23Br3O5 and a molecular weight of 511.05 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 5-O-(2,2,2-tribromoethyl) 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-(2-hydroxyethyl) 5-O-(2,2,2-tribromoethyl) 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 59343000 |
| Molecular Formula | C14H23Br3O5 |
| Molecular Weight | 511.05 g/mol |
| Exact Mass | 507.91 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 5-O-(2,2,2-tribromoethyl) 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(Br)(Br)Br)C(=O)OCCO |
| InChI | InChI=1S/C14H23Br3O5/c1-5-13(4,11(20)21-7-6-18)8-12(2,3)10(19)22-9-14(15,16)17/h18H,5-9H2,1-4H3 |
| InChIKey | PHWDAGWNJWJXEV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.05 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|