C24H44O8 — CID 59861880
3-O-hexyl 1-O,5-O-bis(2-hydroxyethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 59861880) has the molecular formula C24H44O8 and a molecular weight of 460.61 g/mol. Its IUPAC name is 3-O-hexyl 1-O,5-O-bis(2-hydroxyethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-hexyl 1-O,5-O-bis(2-hydroxyethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59861880 |
| Molecular Formula | C24H44O8 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 3-O-hexyl 1-O,5-O-bis(2-hydroxyethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCCCCCOC(=O)C(C)(CC(C)(C)C(=O)OCCO)CC(C)(CC)C(=O)OCCO |
| InChI | InChI=1S/C24H44O8/c1-7-9-10-11-14-30-21(29)24(6,17-22(3,4)19(27)31-15-12-25)18-23(5,8-2)20(28)32-16-13-26/h25-26H,7-18H2,1-6H3 |
| InChIKey | LTIYONZIFKHCMZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|