C22H40O6 — CID 58133001
butyl 2-(2-ethyl-5-hydroxy-2-methyl-3-oxopentyl)-7-hydroxy-2,4,4-trimethyl-5-oxoheptanoate (PubChem CID 58133001) has the molecular formula C22H40O6 and a molecular weight of 400.56 g/mol. Its IUPAC name is butyl 2-(2-ethyl-5-hydroxy-2-methyl-3-oxopentyl)-7-hydroxy-2,4,4-trimethyl-5-oxoheptanoate.
| Compound Name | butyl 2-(2-ethyl-5-hydroxy-2-methyl-3-oxopentyl)-7-hydroxy-2,4,4-trimethyl-5-oxoheptanoate |
|---|---|
| PubChem CID | 58133001 |
| Molecular Formula | C22H40O6 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | butyl 2-(2-ethyl-5-hydroxy-2-methyl-3-oxopentyl)-7-hydroxy-2,4,4-trimethyl-5-oxoheptanoate |
| SMILES | CCCCOC(=O)C(C)(CC(C)(C)C(=O)CCO)CC(C)(CC)C(=O)CCO |
| InChI | InChI=1S/C22H40O6/c1-7-9-14-28-19(27)22(6,15-20(3,4)17(25)10-12-23)16-21(5,8-2)18(26)11-13-24/h23-24H,7-16H2,1-6H3 |
| InChIKey | JADJMDASJLFGDP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|