C44H87N3O6 — CID 134463645
tris[2-(dibutylamino)ethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 134463645) has the molecular formula C44H87N3O6 and a molecular weight of 754.19 g/mol. Its IUPAC name is tris[2-(dibutylamino)ethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | tris[2-(dibutylamino)ethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134463645 |
| Molecular Formula | C44H87N3O6 |
| Molecular Weight | 754.19 g/mol |
| Exact Mass | 753.66 |
| IUPAC Name | tris[2-(dibutylamino)ethyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCCCN(CCCC)CCOC(=O)C(C)(C)CC(C)(CC(C)(CC)C(=O)OCCN(CCCC)CCCC)C(=O)OCCN(CCCC)CCCC |
| InChI | InChI=1S/C44H87N3O6/c1-12-19-25-45(26-20-13-2)31-34-51-39(48)42(8,9)37-44(11,41(50)53-36-33-47(29-23-16-5)30-24-17-6)38-43(10,18-7)40(49)52-35-32-46(27-21-14-3)28-22-15-4/h12-38H2,1-11H3 |
| InChIKey | ZQPRSQNZEDJUNC-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.19 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|