C19H39N2O4+ — CID 158569103
2-[5-[2-(dimethylamino)ethoxy]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]oxyethyl-trimethylazanium (PubChem CID 158569103) has the molecular formula C19H39N2O4+ and a molecular weight of 359.53 g/mol. Its IUPAC name is 2-[5-[2-(dimethylamino)ethoxy]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[5-[2-(dimethylamino)ethoxy]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 158569103 |
| Molecular Formula | C19H39N2O4+ |
| Molecular Weight | 359.53 g/mol |
| Exact Mass | 359.29 |
| IUPAC Name | 2-[5-[2-(dimethylamino)ethoxy]-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl]oxyethyl-trimethylazanium |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCN(C)C)C(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C19H39N2O4/c1-10-19(4,17(23)25-14-12-21(7,8)9)15-18(2,3)16(22)24-13-11-20(5)6/h10-15H2,1-9H3/q+1 |
| InChIKey | CUTNHTQSLAAFFJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|