C20H42N2O5 — CID 91448235
2-(dimethylamino)ethyl 2,2-dimethylbutanoate;2-(2,2-dimethylbutanoyloxy)-N,N-dimethylethanamine oxide (PubChem CID 91448235) has the molecular formula C20H42N2O5 and a molecular weight of 390.57 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2,2-dimethylbutanoate;2-(2,2-dimethylbutanoyloxy)-N,N-dimethylethanamine oxide.
| Compound Name | 2-(dimethylamino)ethyl 2,2-dimethylbutanoate;2-(2,2-dimethylbutanoyloxy)-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 91448235 |
| Molecular Formula | C20H42N2O5 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-(dimethylamino)ethyl 2,2-dimethylbutanoate;2-(2,2-dimethylbutanoyloxy)-N,N-dimethylethanamine oxide |
| SMILES | CCC(C)(C)C(=O)OCCN(C)C.CCC(C)(C)C(=O)OCC[N+](C)(C)[O-] |
| InChI | InChI=1S/C10H21NO3.C10H21NO2/c1-6-10(2,3)9(12)14-8-7-11(4,5)13;1-6-10(2,3)9(12)13-8-7-11(4)5/h6-8H2,1-5H3;6-8H2,1-5H3 |
| InChIKey | DSHLDYTWJMROOW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|