C24H47NO8 — CID 158225979
bis(2-hydroxypropyl) 2-ethyl-4-methylpentanedioate;2-(dimethylamino)ethyl 2,2-dimethylbutanoate (PubChem CID 158225979) has the molecular formula C24H47NO8 and a molecular weight of 477.64 g/mol. Its IUPAC name is bis(2-hydroxypropyl) 2-ethyl-4-methylpentanedioate;2-(dimethylamino)ethyl 2,2-dimethylbutanoate.
| Compound Name | bis(2-hydroxypropyl) 2-ethyl-4-methylpentanedioate;2-(dimethylamino)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 158225979 |
| Molecular Formula | C24H47NO8 |
| Molecular Weight | 477.64 g/mol |
| Exact Mass | 477.33 |
| IUPAC Name | bis(2-hydroxypropyl) 2-ethyl-4-methylpentanedioate;2-(dimethylamino)ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCN(C)C.CCC(CC(C)C(=O)OCC(C)O)C(=O)OCC(C)O |
| InChI | InChI=1S/C14H26O6.C10H21NO2/c1-5-12(14(18)20-8-11(4)16)6-9(2)13(17)19-7-10(3)15;1-6-10(2,3)9(12)13-8-7-11(4)5/h9-12,15-16H,5-8H2,1-4H3;6-8H2,1-5H3 |
| InChIKey | GDUNPLVHMJMMFU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.64 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|