C22H37NO5 — CID 160765535
2-(dimethylamino)ethyl 2,2-dimethylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate (PubChem CID 160765535) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2,2-dimethylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate.
| Compound Name | 2-(dimethylamino)ethyl 2,2-dimethylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 160765535 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 2-(dimethylamino)ethyl 2,2-dimethylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCN(C)C.CCC(C)(C)C(=O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C12H16O3.C10H21NO2/c1-4-12(2,3)11(14)15-10-7-5-9(13)6-8-10;1-6-10(2,3)9(12)13-8-7-11(4)5/h5-8,13H,4H2,1-3H3;6-8H2,1-5H3 |
| InChIKey | RYQDNSBWHPDQJX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|