C22H30O4 — CID 162034516
4-butan-2-ylphenol;(4-hydroxyphenyl) 2,2-dimethylbutanoate (PubChem CID 162034516) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 4-butan-2-ylphenol;(4-hydroxyphenyl) 2,2-dimethylbutanoate.
| Compound Name | 4-butan-2-ylphenol;(4-hydroxyphenyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 162034516 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 4-butan-2-ylphenol;(4-hydroxyphenyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(O)cc1.CCC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H16O3.C10H14O/c1-4-12(2,3)11(14)15-10-7-5-9(13)6-8-10;1-3-8(2)9-4-6-10(11)7-5-9/h5-8,13H,4H2,1-3H3;4-8,11H,3H2,1-2H3 |
| InChIKey | YWLSZAQPAVZIMZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|