C41H50O6 — CID 158265168
4-butan-2-ylphenol;9H-fluoren-9-yl 2,2-dimethylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate (PubChem CID 158265168) has the molecular formula C41H50O6 and a molecular weight of 638.85 g/mol. Its IUPAC name is 4-butan-2-ylphenol;9H-fluoren-9-yl 2,2-dimethylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate.
| Compound Name | 4-butan-2-ylphenol;9H-fluoren-9-yl 2,2-dimethylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 158265168 |
| Molecular Formula | C41H50O6 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.36 |
| IUPAC Name | 4-butan-2-ylphenol;9H-fluoren-9-yl 2,2-dimethylbutanoate;(4-hydroxyphenyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1c2ccccc2-c2ccccc21.CCC(C)(C)C(=O)Oc1ccc(O)cc1.CCC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H20O2.C12H16O3.C10H14O/c1-4-19(2,3)18(20)21-17-15-11-7-5-9-13(15)14-10-6-8-12-16(14)17;1-4-12(2,3)11(14)15-10-7-5-9(13)6-8-10;1-3-8(2)9-4-6-10(11)7-5-9/h5-12,17H,4H2,1-3H3;5-8,13H,4H2,1-3H3;4-8,11H,3H2,1-2H3 |
| InChIKey | GIIRBXZONJGZCL-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|