C23H35F3O4 — CID 158786639
(4-butan-2-ylphenyl) 3,3,3-trifluoropropanoate;tert-butyl 2,2-dimethylbutanoate (PubChem CID 158786639) has the molecular formula C23H35F3O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is (4-butan-2-ylphenyl) 3,3,3-trifluoropropanoate;tert-butyl 2,2-dimethylbutanoate.
| Compound Name | (4-butan-2-ylphenyl) 3,3,3-trifluoropropanoate;tert-butyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 158786639 |
| Molecular Formula | C23H35F3O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (4-butan-2-ylphenyl) 3,3,3-trifluoropropanoate;tert-butyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)(C)C.CCC(C)c1ccc(OC(=O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O2.C10H20O2/c1-3-9(2)10-4-6-11(7-5-10)18-12(17)8-13(14,15)16;1-7-10(5,6)8(11)12-9(2,3)4/h4-7,9H,3,8H2,1-2H3;7H2,1-6H3 |
| InChIKey | IRTNSYPIWDJTOW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|