C14H15F2O7S- — CID 58364046
2-[2-(4-butan-2-ylphenoxy)-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 58364046) has the molecular formula C14H15F2O7S- and a molecular weight of 365.33 g/mol. Its IUPAC name is 2-[2-(4-butan-2-ylphenoxy)-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[2-(4-butan-2-ylphenoxy)-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 58364046 |
| Molecular Formula | C14H15F2O7S- |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 2-[2-(4-butan-2-ylphenoxy)-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CCC(C)c1ccc(OC(=O)COC(=O)C(F)(F)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H16F2O7S/c1-3-9(2)10-4-6-11(7-5-10)23-12(17)8-22-13(18)14(15,16)24(19,20)21/h4-7,9H,3,8H2,1-2H3,(H,19,20,21)/p-1 |
| InChIKey | LNLOENWMDPCXQZ-UHFFFAOYSA-M |
| XLogP | 1.79 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|