C13H18F2O4S — CID 118423882
2-(4-butan-2-ylphenoxy)-1,1-difluoropropane-1-sulfonic acid (PubChem CID 118423882) has the molecular formula C13H18F2O4S and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenoxy)-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-(4-butan-2-ylphenoxy)-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 118423882 |
| Molecular Formula | C13H18F2O4S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(4-butan-2-ylphenoxy)-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CCC(C)c1ccc(OC(C)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H18F2O4S/c1-4-9(2)11-5-7-12(8-6-11)19-10(3)13(14,15)20(16,17)18/h5-10H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | QUWGSMFRPNESAQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|