C29H35F2O4S2+ — CID 157275746
bis(4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]sulfanium (PubChem CID 157275746) has the molecular formula C29H35F2O4S2+ and a molecular weight of 549.73 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]sulfanium.
| Compound Name | bis(4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]sulfanium |
|---|---|
| PubChem CID | 157275746 |
| Molecular Formula | C29H35F2O4S2+ |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | bis(4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]sulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C29H34F2O4S2/c1-20(29(30,31)37(32,33)34)35-23-12-18-26(19-13-23)36(24-14-8-21(9-15-24)27(2,3)4)25-16-10-22(11-17-25)28(5,6)7/h8-20H,1-7H3/p+1 |
| InChIKey | GFTILODJGZKLAJ-UHFFFAOYSA-O |
| XLogP | 7.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|