C32H39F2O6S2+ — CID 158636531
(4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2,4-dimethyl-1,3-dioxepan-2-yl)phenyl]sulfanium (PubChem CID 158636531) has the molecular formula C32H39F2O6S2+ and a molecular weight of 621.79 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2,4-dimethyl-1,3-dioxepan-2-yl)phenyl]sulfanium.
| Compound Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2,4-dimethyl-1,3-dioxepan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 158636531 |
| Molecular Formula | C32H39F2O6S2+ |
| Molecular Weight | 621.79 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2,4-dimethyl-1,3-dioxepan-2-yl)phenyl]sulfanium |
| SMILES | CC1CCCOC(C)(c2ccc([S+](c3ccc(OC(C)C(F)(F)S(=O)(=O)O)cc3)c3ccc(C(C)(C)C)cc3)cc2)O1 |
| InChI | InChI=1S/C32H38F2O6S2/c1-22-8-7-21-38-31(6,40-22)25-11-17-28(18-12-25)41(27-15-9-24(10-16-27)30(3,4)5)29-19-13-26(14-20-29)39-23(2)32(33,34)42(35,36)37/h9-20,22-23H,7-8,21H2,1-6H3/p+1 |
| InChIKey | NHGQFQKBNLLFRU-UHFFFAOYSA-O |
| XLogP | 7.72 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.79 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|