C28H34F3O5S2+ — CID 57264171
[(4-methylphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium (PubChem CID 57264171) has the molecular formula C28H34F3O5S2+ and a molecular weight of 571.70 g/mol. Its IUPAC name is [(4-methylphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium.
| Compound Name | [(4-methylphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
|---|---|
| PubChem CID | 57264171 |
| Molecular Formula | C28H34F3O5S2+ |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | [(4-methylphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
| SMILES | Cc1ccc(S([OH+]S(=O)(=O)C(F)(F)F)(c2ccc(OC(C)(C)C)cc2)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H33F3O5S2/c1-20-8-14-23(15-9-20)37(36-38(32,33)28(29,30)31,24-16-10-21(11-17-24)34-26(2,3)4)25-18-12-22(13-19-25)35-27(5,6)7/h8-19H,1-7H3/p+1 |
| InChIKey | OHMLRUJHWXSGFW-UHFFFAOYSA-O |
| XLogP | 8.49 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|