C27H31F2O8S2+ — CID 157187831
[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-bis[4-(2-methoxyethoxy)phenyl]sulfanium (PubChem CID 157187831) has the molecular formula C27H31F2O8S2+ and a molecular weight of 585.67 g/mol. Its IUPAC name is [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-bis[4-(2-methoxyethoxy)phenyl]sulfanium.
| Compound Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-bis[4-(2-methoxyethoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 157187831 |
| Molecular Formula | C27H31F2O8S2+ |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-bis[4-(2-methoxyethoxy)phenyl]sulfanium |
| SMILES | COCCOc1ccc([S+](c2ccc(OCCOC)cc2)c2ccc(OC(C)C(F)(F)S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H30F2O8S2/c1-20(27(28,29)39(30,31)32)37-23-8-14-26(15-9-23)38(24-10-4-21(5-11-24)35-18-16-33-2)25-12-6-22(7-13-25)36-19-17-34-3/h4-15,20H,16-19H2,1-3H3/p+1 |
| InChIKey | ADTTTZOLOVSLAU-UHFFFAOYSA-O |
| XLogP | 5.08 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|