C23H21F2O6S2+ — CID 157134999
[4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 157134999) has the molecular formula C23H21F2O6S2+ and a molecular weight of 495.55 g/mol. Its IUPAC name is [4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 157134999 |
| Molecular Formula | C23H21F2O6S2+ |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | [4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxy-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | CC(OC(=O)COc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C23H20F2O6S2/c1-17(23(24,25)33(27,28)29)31-22(26)16-30-18-12-14-21(15-13-18)32(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,17H,16H2,1H3/p+1 |
| InChIKey | LEFFBFSMJRPXQV-UHFFFAOYSA-O |
| XLogP | 4.57 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|