C26H29F2O7S2+ — CID 158077425
[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-phenylsulfanium (PubChem CID 158077425) has the molecular formula C26H29F2O7S2+ and a molecular weight of 555.64 g/mol. Its IUPAC name is [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-phenylsulfanium.
| Compound Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 158077425 |
| Molecular Formula | C26H29F2O7S2+ |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-phenylsulfanium |
| SMILES | COCCOCCOc1ccc([S+](c2ccccc2)c2ccc(OC(C)C(F)(F)S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H28F2O7S2/c1-20(26(27,28)37(29,30)31)35-22-10-14-25(15-11-22)36(23-6-4-3-5-7-23)24-12-8-21(9-13-24)34-19-18-33-17-16-32-2/h3-15,20H,16-19H2,1-2H3/p+1 |
| InChIKey | ZYLYZRCKGNKNJO-UHFFFAOYSA-O |
| XLogP | 5.07 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|