C21H18F2O4S2+2 — CID 161420886
[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-diphenylsulfanium (PubChem CID 161420886) has the molecular formula C21H18F2O4S2+2 and a molecular weight of 436.50 g/mol. Its IUPAC name is [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-diphenylsulfanium.
| Compound Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 161420886 |
| Molecular Formula | C21H18F2O4S2+2 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-diphenylsulfanium |
| SMILES | [CH2+]C(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C21H17F2O4S2/c1-16(21(22,23)29(24,25)26)27-17-12-14-20(15-13-17)28(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-16H,1H2/q+1/p+1 |
| InChIKey | IEWLXSVDYYJIOR-UHFFFAOYSA-O |
| XLogP | 4.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|