C22H16F7O6S2+ — CID 154594391
[4-(1,1,1,3,4,4,4-heptafluoro-3-sulfobutan-2-yl)oxyphenyl]-bis(4-hydroxyphenyl)sulfanium (PubChem CID 154594391) has the molecular formula C22H16F7O6S2+ and a molecular weight of 573.48 g/mol. Its IUPAC name is [4-(1,1,1,3,4,4,4-heptafluoro-3-sulfobutan-2-yl)oxyphenyl]-bis(4-hydroxyphenyl)sulfanium.
| Compound Name | [4-(1,1,1,3,4,4,4-heptafluoro-3-sulfobutan-2-yl)oxyphenyl]-bis(4-hydroxyphenyl)sulfanium |
|---|---|
| PubChem CID | 154594391 |
| Molecular Formula | C22H16F7O6S2+ |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | [4-(1,1,1,3,4,4,4-heptafluoro-3-sulfobutan-2-yl)oxyphenyl]-bis(4-hydroxyphenyl)sulfanium |
| SMILES | O=S(=O)(O)C(F)(C(Oc1ccc([S+](c2ccc(O)cc2)c2ccc(O)cc2)cc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H15F7O6S2/c23-20(22(27,28)29,37(32,33)34)19(21(24,25)26)35-15-5-11-18(12-6-15)36(16-7-1-13(30)2-8-16)17-9-3-14(31)4-10-17/h1-12,19H,(H2-,30,31,32,33,34)/p+1 |
| InChIKey | KWADDGYQDUJLJE-UHFFFAOYSA-O |
| XLogP | 5.62 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|