C20H16F2O5S2 — CID 154594518
1,1-difluoro-2-[4-[(4-hydroxyphenyl)-phenylsulfonio]phenoxy]ethanesulfonate (PubChem CID 154594518) has the molecular formula C20H16F2O5S2 and a molecular weight of 438.47 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-[(4-hydroxyphenyl)-phenylsulfonio]phenoxy]ethanesulfonate.
| Compound Name | 1,1-difluoro-2-[4-[(4-hydroxyphenyl)-phenylsulfonio]phenoxy]ethanesulfonate |
|---|---|
| PubChem CID | 154594518 |
| Molecular Formula | C20H16F2O5S2 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 1,1-difluoro-2-[4-[(4-hydroxyphenyl)-phenylsulfonio]phenoxy]ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)COc1ccc([S+](c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C20H16F2O5S2/c21-20(22,29(24,25)26)14-27-16-8-12-19(13-9-16)28(17-4-2-1-3-5-17)18-10-6-15(23)7-11-18/h1-13H,14H2,(H-,23,24,25,26) |
| InChIKey | NOVXFVIJVPXXEC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|