C19H13F5O4S2 — CID 18411309
bis(4-fluorophenyl)-(4-hydroxyphenyl)sulfanium;trifluoromethanesulfonate (PubChem CID 18411309) has the molecular formula C19H13F5O4S2 and a molecular weight of 464.43 g/mol. Its IUPAC name is bis(4-fluorophenyl)-(4-hydroxyphenyl)sulfanium;trifluoromethanesulfonate.
| Compound Name | bis(4-fluorophenyl)-(4-hydroxyphenyl)sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18411309 |
| Molecular Formula | C19H13F5O4S2 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | bis(4-fluorophenyl)-(4-hydroxyphenyl)sulfanium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.Oc1ccc([S+](c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H12F2OS.CHF3O3S/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18;2-1(3,4)8(5,6)7/h1-12H;(H,5,6,7) |
| InChIKey | DGHWIWLPQJTBRO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|