C19H16O6S — CID 158302778
hydrogen carbonate;tris(4-hydroxyphenyl)sulfanium (PubChem CID 158302778) has the molecular formula C19H16O6S and a molecular weight of 372.40 g/mol. Its IUPAC name is hydrogen carbonate;tris(4-hydroxyphenyl)sulfanium.
| Compound Name | hydrogen carbonate;tris(4-hydroxyphenyl)sulfanium |
|---|---|
| PubChem CID | 158302778 |
| Molecular Formula | C19H16O6S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | hydrogen carbonate;tris(4-hydroxyphenyl)sulfanium |
| SMILES | O=C([O-])O.Oc1ccc([S+](c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H14O3S.CH2O3/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18;2-1(3)4/h1-12H,(H2-,19,20,21);(H2,2,3,4) |
| InChIKey | GMRUUIRUJLAEST-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|