C40H30F4O4S2 — CID 87756710
2,2,3,3-tetrafluorobutanedioate;bis(triphenylsulfanium) (PubChem CID 87756710) has the molecular formula C40H30F4O4S2 and a molecular weight of 714.80 g/mol. Its IUPAC name is 2,2,3,3-tetrafluorobutanedioate;bis(triphenylsulfanium).
| Compound Name | 2,2,3,3-tetrafluorobutanedioate;bis(triphenylsulfanium) |
|---|---|
| PubChem CID | 87756710 |
| Molecular Formula | C40H30F4O4S2 |
| Molecular Weight | 714.80 g/mol |
| Exact Mass | 714.15 |
| IUPAC Name | 2,2,3,3-tetrafluorobutanedioate;bis(triphenylsulfanium) |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15S.C4H2F4O4/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;5-3(6,1(9)10)4(7,8)2(11)12/h2*1-15H;(H,9,10)(H,11,12)/q2*+1;/p-2 |
| InChIKey | HFKCJUHBWXMPQX-UHFFFAOYSA-L |
| XLogP | 7.32 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.80 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|