C32H39F3O2S — CID 172836354
bis(4-hexylphenyl)-phenylsulfanium;2,2,2-trifluoroacetate (PubChem CID 172836354) has the molecular formula C32H39F3O2S and a molecular weight of 544.72 g/mol. Its IUPAC name is bis(4-hexylphenyl)-phenylsulfanium;2,2,2-trifluoroacetate.
| Compound Name | bis(4-hexylphenyl)-phenylsulfanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 172836354 |
| Molecular Formula | C32H39F3O2S |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | bis(4-hexylphenyl)-phenylsulfanium;2,2,2-trifluoroacetate |
| SMILES | CCCCCCc1ccc([S+](c2ccccc2)c2ccc(CCCCCC)cc2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C30H39S.C2HF3O2/c1-3-5-7-10-14-26-18-22-29(23-19-26)31(28-16-12-9-13-17-28)30-24-20-27(21-25-30)15-11-8-6-4-2;3-2(4,5)1(6)7/h9,12-13,16-25H,3-8,10-11,14-15H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | WEVRWOJTJWIIDX-UHFFFAOYSA-M |
| XLogP | 8.33 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|