About 2-fluoroacetic acid;nonylbenzene
2-fluoroacetic acid;nonylbenzene (PubChem CID 162096715) has the molecular formula C17H27FO2
and a molecular weight of 282.40 g/mol. Its IUPAC name is 2-fluoroacetic acid;nonylbenzene.
Molecular Properties
| Compound Name | 2-fluoroacetic acid;nonylbenzene |
| PubChem CID | 162096715 |
| Molecular Formula | C17H27FO2 |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 2-fluoroacetic acid;nonylbenzene |
| SMILES | CCCCCCCCCc1ccccc1.O=C(O)CF |
| InChI | InChI=1S/C15H24.C2H3FO2/c1-2-3-4-5-6-7-9-12-15-13-10-8-11-14-15;3-1-2(4)5/h8,10-11,13-14H,2-7,9,12H2,1H3;1H2,(H,4,5) |
| InChIKey | ZEIOPRJAKCANJN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroacetic acid;nonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroacetic acid;nonylbenzene?
The IUPAC name of 2-fluoroacetic acid;nonylbenzene (CID 162096715) is 2-fluoroacetic acid;nonylbenzene.
What is the SMILES notation for 2-fluoroacetic acid;nonylbenzene?
The canonical SMILES for 2-fluoroacetic acid;nonylbenzene is CCCCCCCCCc1ccccc1.O=C(O)CF.
What is the InChIKey of 2-fluoroacetic acid;nonylbenzene?
The InChIKey is ZEIOPRJAKCANJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24.C2H3FO2/c1-2-3-4-5-6-7-9-12-15-13-10-8-11-14-15;3-1-2(4)5/h8,10-11,13-14H,2-7,9,12H2,1H3;1H2,(H,4,5).
What are the key properties of 2-fluoroacetic acid;nonylbenzene?
2-fluoroacetic acid;nonylbenzene has a molecular weight of 282.40 g/mol, XLogP of 5.02, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroacetic acid;nonylbenzene is sourced from PubChem (CID 162096715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).