About heptylbenzene;3-methylbutanoic acid
heptylbenzene;3-methylbutanoic acid (PubChem CID 155109045) has the molecular formula C18H30O2
and a molecular weight of 278.44 g/mol. Its IUPAC name is heptylbenzene;3-methylbutanoic acid.
Molecular Properties
| Compound Name | heptylbenzene;3-methylbutanoic acid |
| PubChem CID | 155109045 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | heptylbenzene;3-methylbutanoic acid |
| SMILES | CC(C)CC(=O)O.CCCCCCCc1ccccc1 |
| InChI | InChI=1S/C13H20.C5H10O2/c1-2-3-4-5-7-10-13-11-8-6-9-12-13;1-4(2)3-5(6)7/h6,8-9,11-12H,2-5,7,10H2,1H3;4H,3H2,1-2H3,(H,6,7) |
| InChIKey | LKKNOMGIWQAURI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptylbenzene;3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptylbenzene;3-methylbutanoic acid?
The IUPAC name of heptylbenzene;3-methylbutanoic acid (CID 155109045) is heptylbenzene;3-methylbutanoic acid.
What is the SMILES notation for heptylbenzene;3-methylbutanoic acid?
The canonical SMILES for heptylbenzene;3-methylbutanoic acid is CC(C)CC(=O)O.CCCCCCCc1ccccc1.
What is the InChIKey of heptylbenzene;3-methylbutanoic acid?
The InChIKey is LKKNOMGIWQAURI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20.C5H10O2/c1-2-3-4-5-7-10-13-11-8-6-9-12-13;1-4(2)3-5(6)7/h6,8-9,11-12H,2-5,7,10H2,1H3;4H,3H2,1-2H3,(H,6,7).
What are the key properties of heptylbenzene;3-methylbutanoic acid?
heptylbenzene;3-methylbutanoic acid has a molecular weight of 278.44 g/mol, XLogP of 5.32, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptylbenzene;3-methylbutanoic acid is sourced from PubChem (CID 155109045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).