C28H34F2O3S2 — CID 159227547
difluoromethanesulfonate;(4-nonylphenyl)-diphenylsulfanium (PubChem CID 159227547) has the molecular formula C28H34F2O3S2 and a molecular weight of 520.71 g/mol. Its IUPAC name is difluoromethanesulfonate;(4-nonylphenyl)-diphenylsulfanium.
| Compound Name | difluoromethanesulfonate;(4-nonylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 159227547 |
| Molecular Formula | C28H34F2O3S2 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | difluoromethanesulfonate;(4-nonylphenyl)-diphenylsulfanium |
| SMILES | CCCCCCCCCc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])C(F)F |
| InChI | InChI=1S/C27H33S.CH2F2O3S/c1-2-3-4-5-6-7-10-15-24-20-22-27(23-21-24)28(25-16-11-8-12-17-25)26-18-13-9-14-19-26;2-1(3)7(4,5)6/h8-9,11-14,16-23H,2-7,10,15H2,1H3;1H,(H,4,5,6)/q+1;/p-1 |
| InChIKey | KSMFKOMNIMEVQU-UHFFFAOYSA-M |
| XLogP | 7.83 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|