About heptanoate;triphenylsulfanium
heptanoate;triphenylsulfanium (PubChem CID 87067214) has the molecular formula C25H28O2S
and a molecular weight of 392.56 g/mol. Its IUPAC name is heptanoate;triphenylsulfanium.
Molecular Properties
| Compound Name | heptanoate;triphenylsulfanium |
| PubChem CID | 87067214 |
| Molecular Formula | C25H28O2S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | heptanoate;triphenylsulfanium |
| SMILES | CCCCCCC(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C7H14O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-5-6-7(8)9/h1-15H;2-6H2,1H3,(H,8,9)/q+1;/p-1 |
| InChIKey | LBEVMQIXHPPFPA-UHFFFAOYSA-M |
| XLogP | 5.49 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze heptanoate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptanoate;triphenylsulfanium?
The IUPAC name of heptanoate;triphenylsulfanium (CID 87067214) is heptanoate;triphenylsulfanium.
What is the SMILES notation for heptanoate;triphenylsulfanium?
The canonical SMILES for heptanoate;triphenylsulfanium is CCCCCCC(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of heptanoate;triphenylsulfanium?
The InChIKey is LBEVMQIXHPPFPA-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C7H14O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-5-6-7(8)9/h1-15H;2-6H2,1H3,(H,8,9)/q+1;/p-1.
What are the key properties of heptanoate;triphenylsulfanium?
heptanoate;triphenylsulfanium has a molecular weight of 392.56 g/mol, XLogP of 5.49, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptanoate;triphenylsulfanium is sourced from PubChem (CID 87067214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).