About dodecanoate;tin(2+);acetate
dodecanoate;tin(2+);acetate (PubChem CID 157367656) has the molecular formula C14H26O4Sn
and a molecular weight of 377.07 g/mol. Its IUPAC name is dodecanoate;tin(2+);acetate.
Molecular Properties
| Compound Name | dodecanoate;tin(2+);acetate |
| PubChem CID | 157367656 |
| Molecular Formula | C14H26O4Sn |
| Molecular Weight | 377.07 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | dodecanoate;tin(2+);acetate |
| SMILES | CC(=O)[O-].CCCCCCCCCCCC(=O)[O-].[Sn+2] |
| InChI | InChI=1S/C12H24O2.C2H4O2.Sn/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-2(3)4;/h2-11H2,1H3,(H,13,14);1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | BJJMQJWQXQQKKF-UHFFFAOYSA-L |
| XLogP | 1.03 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.07 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecanoate;tin(2+);acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecanoate;tin(2+);acetate?
The IUPAC name of dodecanoate;tin(2+);acetate (CID 157367656) is dodecanoate;tin(2+);acetate.
What is the SMILES notation for dodecanoate;tin(2+);acetate?
The canonical SMILES for dodecanoate;tin(2+);acetate is CC(=O)[O-].CCCCCCCCCCCC(=O)[O-].[Sn+2].
What is the InChIKey of dodecanoate;tin(2+);acetate?
The InChIKey is BJJMQJWQXQQKKF-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H24O2.C2H4O2.Sn/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-2(3)4;/h2-11H2,1H3,(H,13,14);1H3,(H,3,4);/q;;+2/p-2.
What are the key properties of dodecanoate;tin(2+);acetate?
dodecanoate;tin(2+);acetate has a molecular weight of 377.07 g/mol, XLogP of 1.03, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dodecanoate;tin(2+);acetate is sourced from PubChem (CID 157367656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).