C27H32O3S — CID 158869247
butanoate;(4-pentoxyphenyl)-diphenylsulfanium (PubChem CID 158869247) has the molecular formula C27H32O3S and a molecular weight of 436.62 g/mol. Its IUPAC name is butanoate;(4-pentoxyphenyl)-diphenylsulfanium.
| Compound Name | butanoate;(4-pentoxyphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 158869247 |
| Molecular Formula | C27H32O3S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | butanoate;(4-pentoxyphenyl)-diphenylsulfanium |
| SMILES | CCCC(=O)[O-].CCCCCOc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25OS.C4H8O2/c1-2-3-10-19-24-20-15-17-23(18-16-20)25(21-11-6-4-7-12-21)22-13-8-5-9-14-22;1-2-3-4(5)6/h4-9,11-18H,2-3,10,19H2,1H3;2-3H2,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | JBQCPZBFYQTYOJ-UHFFFAOYSA-M |
| XLogP | 5.89 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|